C23H19FN2O3 — CID 95095513
N-(3-fluoro-4-methylphenyl)-2-[(3S)-3-hydroxy-2-oxo-3-phenylindol-1-yl]acetamide (PubChem CID 95095513) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[(3S)-3-hydroxy-2-oxo-3-phenylindol-1-yl]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[(3S)-3-hydroxy-2-oxo-3-phenylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 95095513 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[(3S)-3-hydroxy-2-oxo-3-phenylindol-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)[C@](O)(c3ccccc3)c3ccccc32)cc1F |
| InChI | InChI=1S/C23H19FN2O3/c1-15-11-12-17(13-19(15)24)25-21(27)14-26-20-10-6-5-9-18(20)23(29,22(26)28)16-7-3-2-4-8-16/h2-13,29H,14H2,1H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | WYVSAODPXNPPEA-QHCPKHFHSA-N |
| XLogP | 3.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |