C23H19ClN2O4 — CID 95095456
2-[(3R)-3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 95095456) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[(3R)-3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(3R)-3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 95095456 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[(3R)-3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2C(=O)[C@@](O)(c3cccc(Cl)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C23H19ClN2O4/c1-30-18-9-5-8-17(13-18)25-21(27)14-26-20-11-3-2-10-19(20)23(29,22(26)28)15-6-4-7-16(24)12-15/h2-13,29H,14H2,1H3,(H,25,27)/t23-/m1/s1 |
| InChIKey | MFEFPQHSZCEKQQ-HSZRJFAPSA-N |
| XLogP | 3.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |