C22H15Cl2FN2O3 — CID 53144210
N-(4-chloro-2-fluorophenyl)-2-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide (PubChem CID 53144210) has the molecular formula C22H15Cl2FN2O3 and a molecular weight of 445.28 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 53144210 |
| Molecular Formula | C22H15Cl2FN2O3 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)C(O)(c2cccc(Cl)c2)c2ccccc21)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H15Cl2FN2O3/c23-14-5-3-4-13(10-14)22(30)16-6-1-2-7-19(16)27(21(22)29)12-20(28)26-18-9-8-15(24)11-17(18)25/h1-11,30H,12H2,(H,26,28) |
| InChIKey | UWZSLOMGUVYGNU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |