C25H23FN2O3 — CID 95095383
N-benzyl-N-ethyl-2-[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide (PubChem CID 95095383) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 95095383 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-benzyl-N-ethyl-2-[(3S)-3-(3-fluorophenyl)-3-hydroxy-2-oxoindol-1-yl]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CN1C(=O)[C@](O)(c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C25H23FN2O3/c1-2-27(16-18-9-4-3-5-10-18)23(29)17-28-22-14-7-6-13-21(22)25(31,24(28)30)19-11-8-12-20(26)15-19/h3-15,31H,2,16-17H2,1H3/t25-/m0/s1 |
| InChIKey | QAROJBIZLTWKPF-VWLOTQADSA-N |
| XLogP | 3.46 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |