C22H22FN3O3 — CID 95917512
N-benzyl-N-ethyl-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide (PubChem CID 95917512) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 95917512 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-benzyl-N-ethyl-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)Cn1ccn(-c2cc(F)ccc2C)c(=O)c1=O |
| InChI | InChI=1S/C22H22FN3O3/c1-3-24(14-17-7-5-4-6-8-17)20(27)15-25-11-12-26(22(29)21(25)28)19-13-18(23)10-9-16(19)2/h4-13H,3,14-15H2,1-2H3 |
| InChIKey | XGZMVBPHZCUXFM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|