C23H25N3O3 — CID 95917583
N-benzyl-2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-ethylacetamide (PubChem CID 95917583) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-benzyl-2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-ethylacetamide.
| Compound Name | N-benzyl-2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 95917583 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-benzyl-2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)Cn1ccn(-c2cc(C)cc(C)c2)c(=O)c1=O |
| InChI | InChI=1S/C23H25N3O3/c1-4-24(15-19-8-6-5-7-9-19)21(27)16-25-10-11-26(23(29)22(25)28)20-13-17(2)12-18(3)14-20/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | GHZDNAWURFGURX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|