C20H16FN3O5 — CID 51370128
N-(1,3-benzodioxol-5-yl)-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide (PubChem CID 51370128) has the molecular formula C20H16FN3O5 and a molecular weight of 397.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 51370128 |
| Molecular Formula | C20H16FN3O5 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[4-(5-fluoro-2-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
| SMILES | Cc1ccc(F)cc1-n1ccn(CC(=O)Nc2ccc3c(c2)OCO3)c(=O)c1=O |
| InChI | InChI=1S/C20H16FN3O5/c1-12-2-3-13(21)8-15(12)24-7-6-23(19(26)20(24)27)10-18(25)22-14-4-5-16-17(9-14)29-11-28-16/h2-9H,10-11H2,1H3,(H,22,25) |
| InChIKey | CMWBPOUJPGDFMT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|