C20H18N2O4 — CID 100744676
N-(1,3-benzodioxol-5-yl)-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide (PubChem CID 100744676) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 100744676 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide |
| SMILES | Cc1cc(C)c2c(=O)ccn(CC(=O)Nc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C20H18N2O4/c1-12-7-13(2)20-15(8-12)22(6-5-16(20)23)10-19(24)21-14-3-4-17-18(9-14)26-11-25-17/h3-9H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | XDIQHSYGEYLOMO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |