C13H16N2O4 — CID 62916161
N-(1,3-benzodioxol-5-yl)-2-(3-hydroxypyrrolidin-1-yl)acetamide (PubChem CID 62916161) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(3-hydroxypyrrolidin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(3-hydroxypyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 62916161 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(3-hydroxypyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCC(O)C1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16N2O4/c16-10-3-4-15(6-10)7-13(17)14-9-1-2-11-12(5-9)19-8-18-11/h1-2,5,10,16H,3-4,6-8H2,(H,14,17) |
| InChIKey | LCQMBHVECKUXOS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |