C18H24N2O3 — CID 11940591
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 11940591) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 11940591 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | O=C(CN1CC[C@H]2CCCC[C@@H]2C1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H24N2O3/c21-18(19-15-5-6-16-17(9-15)23-12-22-16)11-20-8-7-13-3-1-2-4-14(13)10-20/h5-6,9,13-14H,1-4,7-8,10-12H2,(H,19,21)/t13-,14-/m1/s1 |
| InChIKey | QRVDCXRNYFEWRC-ZIAGYGMSSA-N |
| XLogP | 2.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |