C19H26N2O3 — CID 11939355
(2R)-2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 11939355) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2R)-2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | (2R)-2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 11939355 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2R)-2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-N-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc2c(c1)OCO2)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H26N2O3/c1-13(21-9-8-14-4-2-3-5-15(14)11-21)19(22)20-16-6-7-17-18(10-16)24-12-23-17/h6-7,10,13-15H,2-5,8-9,11-12H2,1H3,(H,20,22)/t13-,14+,15-/m1/s1 |
| InChIKey | HFQYYGVHHBPMRZ-QLFBSQMISA-N |
| XLogP | 3.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |