C21H23N3O4 — CID 1443738
2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 1443738) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 1443738 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | CC(=O)c1ccc(N2CCN(CC(=O)Nc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-15(25)16-2-5-18(6-3-16)24-10-8-23(9-11-24)13-21(26)22-17-4-7-19-20(12-17)28-14-27-19/h2-7,12H,8-11,13-14H2,1H3,(H,22,26) |
| InChIKey | NDSROWUBXABBPK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |