C22H23N3O3 — CID 30565603
2-[4-(2-methylphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 30565603) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-(2-methylphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 30565603 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[4-(2-methylphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1ccccc1-n1ccn(CC(=O)Nc2ccc(C(C)C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C22H23N3O3/c1-15(2)17-8-10-18(11-9-17)23-20(26)14-24-12-13-25(22(28)21(24)27)19-7-5-4-6-16(19)3/h4-13,15H,14H2,1-3H3,(H,23,26) |
| InChIKey | KONCEHWNOFPHSQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|