C20H17FN2O3 — CID 7286860
1-(2,5-dimethylphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione (PubChem CID 7286860) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione.
| Compound Name | 1-(2,5-dimethylphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 7286860 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione |
| SMILES | Cc1ccc(C)c(-n2ccn(CC(=O)c3ccc(F)cc3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C20H17FN2O3/c1-13-3-4-14(2)17(11-13)23-10-9-22(19(25)20(23)26)12-18(24)15-5-7-16(21)8-6-15/h3-11H,12H2,1-2H3 |
| InChIKey | DJTZJZIKIOGPSR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|