C19H14ClFN2O4 — CID 7286861
1-(5-chloro-2-methoxyphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione (PubChem CID 7286861) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 7286861 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-4-[2-(4-fluorophenyl)-2-oxoethyl]pyrazine-2,3-dione |
| SMILES | COc1ccc(Cl)cc1-n1ccn(CC(=O)c2ccc(F)cc2)c(=O)c1=O |
| InChI | InChI=1S/C19H14ClFN2O4/c1-27-17-7-4-13(20)10-15(17)23-9-8-22(18(25)19(23)26)11-16(24)12-2-5-14(21)6-3-12/h2-10H,11H2,1H3 |
| InChIKey | JILHGOZGPLIQMI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|