C21H20ClN3O5 — CID 50928900
N-(5-chloro-2-methoxyphenyl)-2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide (PubChem CID 50928900) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 50928900 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
| SMILES | CCOc1ccccc1-n1ccn(CC(=O)Nc2cc(Cl)ccc2OC)c(=O)c1=O |
| InChI | InChI=1S/C21H20ClN3O5/c1-3-30-18-7-5-4-6-16(18)25-11-10-24(20(27)21(25)28)13-19(26)23-15-12-14(22)8-9-17(15)29-2/h4-12H,3,13H2,1-2H3,(H,23,26) |
| InChIKey | PVGDKQUHPGXBJY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|