C19H17N3O4 — CID 22520314
2-(2,3-dioxo-4-phenylpyrazin-1-yl)-N-(2-methoxyphenyl)acetamide (PubChem CID 22520314) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-(2,3-dioxo-4-phenylpyrazin-1-yl)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(2,3-dioxo-4-phenylpyrazin-1-yl)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22520314 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(2,3-dioxo-4-phenylpyrazin-1-yl)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1ccn(-c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C19H17N3O4/c1-26-16-10-6-5-9-15(16)20-17(23)13-21-11-12-22(19(25)18(21)24)14-7-3-2-4-8-14/h2-12H,13H2,1H3,(H,20,23) |
| InChIKey | FSHAIJWFJDLAIU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|