C18H15ClN2O2 — CID 54033837
4-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]butanenitrile (PubChem CID 54033837) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]butanenitrile.
| Compound Name | 4-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 54033837 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-[3-(3-chlorophenyl)-3-hydroxy-2-oxoindol-1-yl]butanenitrile |
| SMILES | N#CCCCN1C(=O)C(O)(c2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C18H15ClN2O2/c19-14-7-5-6-13(12-14)18(23)15-8-1-2-9-16(15)21(17(18)22)11-4-3-10-20/h1-2,5-9,12,23H,3-4,11H2 |
| InChIKey | LHNNJBSOSDQUPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|