C27H29N3O3S — CID 171797033
4-[3-hydroxy-2-methylidene-1-[(4-piperidin-1-ylphenyl)methyl]indol-3-yl]benzenesulfonamide (PubChem CID 171797033) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-[3-hydroxy-2-methylidene-1-[(4-piperidin-1-ylphenyl)methyl]indol-3-yl]benzenesulfonamide.
| Compound Name | 4-[3-hydroxy-2-methylidene-1-[(4-piperidin-1-ylphenyl)methyl]indol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 171797033 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[3-hydroxy-2-methylidene-1-[(4-piperidin-1-ylphenyl)methyl]indol-3-yl]benzenesulfonamide |
| SMILES | C=C1N(Cc2ccc(N3CCCCC3)cc2)c2ccccc2C1(O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-20-27(31,22-11-15-24(16-12-22)34(28,32)33)25-7-3-4-8-26(25)30(20)19-21-9-13-23(14-10-21)29-17-5-2-6-18-29/h3-4,7-16,31H,1-2,5-6,17-19H2,(H2,28,32,33) |
| InChIKey | QINKIAVOLXFXIU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|