C20H24N2O4S — CID 19599666
4-(4-pyrrolidin-1-ylphenyl)-2-(4-sulfamoylphenyl)butanoic acid (PubChem CID 19599666) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(4-pyrrolidin-1-ylphenyl)-2-(4-sulfamoylphenyl)butanoic acid.
| Compound Name | 4-(4-pyrrolidin-1-ylphenyl)-2-(4-sulfamoylphenyl)butanoic acid |
|---|---|
| PubChem CID | 19599666 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(4-pyrrolidin-1-ylphenyl)-2-(4-sulfamoylphenyl)butanoic acid |
| SMILES | NS(=O)(=O)c1ccc(C(CCc2ccc(N3CCCC3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c21-27(25,26)18-10-6-16(7-11-18)19(20(23)24)12-5-15-3-8-17(9-4-15)22-13-1-2-14-22/h3-4,6-11,19H,1-2,5,12-14H2,(H,23,24)(H2,21,25,26) |
| InChIKey | BAKZGUOYIHGZPH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|