C21H28N4O3S — CID 40715955
(2R)-2-(4-phenylpiperazin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 40715955) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is (2R)-2-(4-phenylpiperazin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-phenylpiperazin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 40715955 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2R)-2-(4-phenylpiperazin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@H](C(=O)NCCc1ccc(S(N)(=O)=O)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O3S/c1-17(24-13-15-25(16-14-24)19-5-3-2-4-6-19)21(26)23-12-11-18-7-9-20(10-8-18)29(22,27)28/h2-10,17H,11-16H2,1H3,(H,23,26)(H2,22,27,28)/t17-/m1/s1 |
| InChIKey | CANZOANHSZILBX-QGZVFWFLSA-N |
| XLogP | 1.20 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |