C19H23N3O5S — CID 18778138
(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 18778138) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 18778138 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@@H](C(=O)NCCc1ccc(S(N)(=O)=O)cc1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C19H23N3O5S/c1-12(22-18(24)15-4-2-3-5-16(15)19(22)25)17(23)21-11-10-13-6-8-14(9-7-13)28(20,26)27/h2-3,6-9,12,15-16H,4-5,10-11H2,1H3,(H,21,23)(H2,20,26,27)/t12-,15?,16?/m0/s1 |
| InChIKey | QHMCIZHANDGNTN-JQRITLKVSA-N |
| XLogP | 0.33 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|