C14H19Cl2N3O7 — CID 86603162
(1S,5S)-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate (PubChem CID 86603162) has the molecular formula C14H19Cl2N3O7 and a molecular weight of 412.23 g/mol. Its IUPAC name is (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate.
| Compound Name | (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate |
|---|---|
| PubChem CID | 86603162 |
| Molecular Formula | C14H19Cl2N3O7 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(2R,3R)-2,3-dihydroxybutanedioic acid;hydrate |
| SMILES | Clc1cc(N2C[C@@H]3CN[C@@H]3C2)cnc1Cl.O.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H11Cl2N3.C4H6O6.H2O/c11-8-1-7(3-14-10(8)12)15-4-6-2-13-9(6)5-15;5-1(3(7)8)2(6)4(9)10;/h1,3,6,9,13H,2,4-5H2;1-2,5-6H,(H,7,8)(H,9,10);1H2/t6-,9+;1-,2-;/m01./s1 |
| InChIKey | DYJJIDAKRATZGD-ORYKJRHRSA-N |
| XLogP | -1.15 |
| TPSA | 174.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|