C14H19Cl2N3 — CID 172832388
(1R,5S)-1-tert-butyl-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 172832388) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is (1R,5S)-1-tert-butyl-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | (1R,5S)-1-tert-butyl-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 172832388 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (1R,5S)-1-tert-butyl-3-(5,6-dichloro-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | CC(C)(C)[C@]12CN[C@@H]1CN(c1cnc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C14H19Cl2N3/c1-13(2,3)14-7-18-11(14)6-19(8-14)9-4-10(15)12(16)17-5-9/h4-5,11,18H,6-8H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | VRLGNTYRUVFLJF-RISCZKNCSA-N |
| XLogP | 3.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|