C12H13Cl2N3O2 — CID 87542502
(1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 87542502) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 87542502 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | O=C(O)N1CC[C@H]2CN(c3cnc(Cl)c(Cl)c3)[C@H]2C1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-9-3-8(4-15-11(9)14)17-5-7-1-2-16(12(18)19)6-10(7)17/h3-4,7,10H,1-2,5-6H2,(H,18,19)/t7-,10-/m0/s1 |
| InChIKey | MOUCLEDXVRCELD-XVKPBYJWSA-N |
| XLogP | 2.58 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|