C13H14N4O2 — CID 68701174
(3aR,6aR)-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 68701174) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is (3aR,6aR)-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aR)-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 68701174 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3aR,6aR)-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | N#Cc1cncc(N2CC[C@@H]3CN(C(=O)O)C[C@@H]32)c1 |
| InChI | InChI=1S/C13H14N4O2/c14-4-9-3-11(6-15-5-9)17-2-1-10-7-16(13(18)19)8-12(10)17/h3,5-6,10,12H,1-2,7-8H2,(H,18,19)/t10-,12+/m1/s1 |
| InChIKey | SWKQUAVMVOMWEO-PWSUYJOCSA-N |
| XLogP | 1.14 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |