C19H21N3O3 — CID 68695924
(3aS,6aS)-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 68695924) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3aS,6aS)-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aS,6aS)-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 68695924 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3aS,6aS)-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)N1C[C@@H]2CCN(c3cncc(OCc4ccccc4)c3)[C@@H]2C1 |
| InChI | InChI=1S/C19H21N3O3/c23-19(24)21-11-15-6-7-22(18(15)12-21)16-8-17(10-20-9-16)25-13-14-4-2-1-3-5-14/h1-5,8-10,15,18H,6-7,11-13H2,(H,23,24)/t15-,18+/m0/s1 |
| InChIKey | VGEAZMBORUFCCY-MAUKXSAKSA-N |
| XLogP | 2.85 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |