C22H23N3O3 — CID 89443578
3-methyl-4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid (PubChem CID 89443578) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-methyl-4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid.
| Compound Name | 3-methyl-4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 89443578 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-methyl-4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid |
| SMILES | CC1CN(C(=O)O)CCN1c1cnc2ccc(OCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C22H23N3O3/c1-16-14-24(22(26)27)9-10-25(16)19-11-18-12-20(7-8-21(18)23-13-19)28-15-17-5-3-2-4-6-17/h2-8,11-13,16H,9-10,14-15H2,1H3,(H,26,27) |
| InChIKey | WDIWIAQFDBRCSR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |