C21H21N3O3 — CID 89443969
4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid (PubChem CID 89443969) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 89443969 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(6-phenylmethoxyquinolin-3-yl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2cnc3ccc(OCc4ccccc4)cc3c2)CC1 |
| InChI | InChI=1S/C21H21N3O3/c25-21(26)24-10-8-23(9-11-24)18-12-17-13-19(6-7-20(17)22-14-18)27-15-16-4-2-1-3-5-16/h1-7,12-14H,8-11,15H2,(H,25,26) |
| InChIKey | GKSULMJAKNANNG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |