C23H19F4N3O2 — CID 133371349
(4-phenylmethoxyphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone (PubChem CID 133371349) has the molecular formula C23H19F4N3O2 and a molecular weight of 445.42 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (4-phenylmethoxyphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 133371349 |
| Molecular Formula | C23H19F4N3O2 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (4-phenylmethoxyphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCc2ccccc2)cc1)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C23H19F4N3O2/c24-18-20(19(25)22(27)28-21(18)26)29-10-12-30(13-11-29)23(31)16-6-8-17(9-7-16)32-14-15-4-2-1-3-5-15/h1-9H,10-14H2 |
| InChIKey | WFFFJRYUIPVABI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|