C19H19F4N3O — CID 133371959
4-phenyl-1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]butan-1-one (PubChem CID 133371959) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-phenyl-1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-phenyl-1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 133371959 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 4-phenyl-1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C19H19F4N3O/c20-15-17(16(21)19(23)24-18(15)22)26-11-9-25(10-12-26)14(27)8-4-7-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2 |
| InChIKey | ICKWSEMKSQLFFR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|