C23H29N3O3 — CID 66757416
(3aS,6aS)-2-tert-butyl-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 66757416) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3aS,6aS)-2-tert-butyl-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aS,6aS)-2-tert-butyl-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 66757416 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3aS,6aS)-2-tert-butyl-1-(5-phenylmethoxy-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | CC(C)(C)C1C[C@H]2CN(C(=O)O)C[C@H]2N1c1cncc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,3)21-9-17-13-25(22(27)28)14-20(17)26(21)18-10-19(12-24-11-18)29-15-16-7-5-4-6-8-16/h4-8,10-12,17,20-21H,9,13-15H2,1-3H3,(H,27,28)/t17-,20+,21?/m0/s1 |
| InChIKey | RVLIFWZJTBXYFD-DVUUQMMQSA-N |
| XLogP | 4.26 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |