C19H19NO3 — CID 71746220
methyl (E)-3-[(1R,2S)-2-(5-phenylmethoxy-3-pyridinyl)cyclopropyl]prop-2-enoate (PubChem CID 71746220) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl (E)-3-[(1R,2S)-2-(5-phenylmethoxy-3-pyridinyl)cyclopropyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,2S)-2-(5-phenylmethoxy-3-pyridinyl)cyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 71746220 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl (E)-3-[(1R,2S)-2-(5-phenylmethoxy-3-pyridinyl)cyclopropyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@H]1C[C@@H]1c1cncc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO3/c1-22-19(21)8-7-15-10-18(15)16-9-17(12-20-11-16)23-13-14-5-3-2-4-6-14/h2-9,11-12,15,18H,10,13H2,1H3/b8-7+/t15-,18-/m0/s1 |
| InChIKey | LQWUZEZAFQAMNQ-KJTGTQQJSA-N |
| XLogP | 3.49 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|