C22H21NO2 — CID 59371597
3-[(1S,2R)-2-(phenoxymethyl)cyclopropyl]-5-phenylmethoxypyridine (PubChem CID 59371597) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[(1S,2R)-2-(phenoxymethyl)cyclopropyl]-5-phenylmethoxypyridine.
| Compound Name | 3-[(1S,2R)-2-(phenoxymethyl)cyclopropyl]-5-phenylmethoxypyridine |
|---|---|
| PubChem CID | 59371597 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[(1S,2R)-2-(phenoxymethyl)cyclopropyl]-5-phenylmethoxypyridine |
| SMILES | c1ccc(COc2cncc([C@H]3C[C@H]3COc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21NO2/c1-3-7-17(8-4-1)15-24-21-11-18(13-23-14-21)22-12-19(22)16-25-20-9-5-2-6-10-20/h1-11,13-14,19,22H,12,15-16H2/t19-,22+/m0/s1 |
| InChIKey | XXRNSTNVYSGNCD-SIKLNZKXSA-N |
| XLogP | 4.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |