C18H21Cl2N3O3S — CID 86594332
(1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane;4-methylbenzenesulfonic acid (PubChem CID 86594332) has the molecular formula C18H21Cl2N3O3S and a molecular weight of 430.36 g/mol. Its IUPAC name is (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane;4-methylbenzenesulfonic acid.
| Compound Name | (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86594332 |
| Molecular Formula | C18H21Cl2N3O3S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (1R,6S)-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Clc1cc(N2C[C@@H]3CCNC[C@@H]32)cnc1Cl |
| InChI | InChI=1S/C11H13Cl2N3.C7H8O3S/c12-9-3-8(4-15-11(9)13)16-6-7-1-2-14-5-10(7)16;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,7,10,14H,1-2,5-6H2;2-5H,1H3,(H,8,9,10)/t7-,10-;/m0./s1 |
| InChIKey | JLDRWJHHQYLZJZ-YUWZRIFDSA-N |
| XLogP | 3.43 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|