C18H22ClN3O3S — CID 16748235
(1S,4S)-2-(6-chloro-3-pyridinyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane;4-methylbenzenesulfonic acid (PubChem CID 16748235) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is (1S,4S)-2-(6-chloro-3-pyridinyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane;4-methylbenzenesulfonic acid.
| Compound Name | (1S,4S)-2-(6-chloro-3-pyridinyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 16748235 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (1S,4S)-2-(6-chloro-3-pyridinyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane;4-methylbenzenesulfonic acid |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1ccc(Cl)nc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H14ClN3.C7H8O3S/c1-14-6-10-4-9(14)7-15(10)8-2-3-11(12)13-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h2-3,5,9-10H,4,6-7H2,1H3;2-5H,1H3,(H,8,9,10)/t9-,10-;/m0./s1 |
| InChIKey | MZHCXSXBZNNRJQ-IYPAPVHQSA-N |
| XLogP | 2.87 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|