C16H18ClN3O4S2 — CID 7509881
1-[(6-chloro-3-pyridinyl)sulfonyl]-4-(4-methylphenyl)sulfonylpiperazine (PubChem CID 7509881) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)sulfonyl]-4-(4-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)sulfonyl]-4-(4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 7509881 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)sulfonyl]-4-(4-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(Cl)nc3)CC2)cc1 |
| InChI | InChI=1S/C16H18ClN3O4S2/c1-13-2-4-14(5-3-13)25(21,22)19-8-10-20(11-9-19)26(23,24)15-6-7-16(17)18-12-15/h2-7,12H,8-11H2,1H3 |
| InChIKey | VYQTWSPAMYHUAA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|