C11H14ClN3 — CID 22647012
7-(6-chloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane (PubChem CID 22647012) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 7-(6-chloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane.
| Compound Name | 7-(6-chloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 22647012 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 7-(6-chloro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
| SMILES | Clc1ccc(N2CC3CNCCC32)cn1 |
| InChI | InChI=1S/C11H14ClN3/c12-11-2-1-9(6-14-11)15-7-8-5-13-4-3-10(8)15/h1-2,6,8,10,13H,3-5,7H2 |
| InChIKey | WWYKDUOHHPBKIY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|