C11H14FN3 — CID 22647177
7-(5-fluoro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane (PubChem CID 22647177) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is 7-(5-fluoro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane.
| Compound Name | 7-(5-fluoro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 22647177 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 7-(5-fluoro-3-pyridinyl)-3,7-diazabicyclo[4.2.0]octane |
| SMILES | Fc1cncc(N2CC3CNCCC32)c1 |
| InChI | InChI=1S/C11H14FN3/c12-9-3-10(6-14-5-9)15-7-8-4-13-2-1-11(8)15/h3,5-6,8,11,13H,1-2,4,7H2 |
| InChIKey | DLRFLULJVWWCSZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |