C13H18N2 — CID 70266351
8-(4-methylphenyl)-3,8-diazabicyclo[4.2.0]octane (PubChem CID 70266351) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 8-(4-methylphenyl)-3,8-diazabicyclo[4.2.0]octane.
| Compound Name | 8-(4-methylphenyl)-3,8-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 70266351 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 8-(4-methylphenyl)-3,8-diazabicyclo[4.2.0]octane |
| SMILES | Cc1ccc(N2CC3CCNCC32)cc1 |
| InChI | InChI=1S/C13H18N2/c1-10-2-4-12(5-3-10)15-9-11-6-7-14-8-13(11)15/h2-5,11,13-14H,6-9H2,1H3 |
| InChIKey | SQBUJYBUXMNNSQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|