C17H22BrN3O5 — CID 86584385
(3aR,6aR)-5-[6-bromo-5-(methoxymethyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;(E)-but-2-enedioic acid (PubChem CID 86584385) has the molecular formula C17H22BrN3O5 and a molecular weight of 428.28 g/mol. Its IUPAC name is (3aR,6aR)-5-[6-bromo-5-(methoxymethyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;(E)-but-2-enedioic acid.
| Compound Name | (3aR,6aR)-5-[6-bromo-5-(methoxymethyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 86584385 |
| Molecular Formula | C17H22BrN3O5 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (3aR,6aR)-5-[6-bromo-5-(methoxymethyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;(E)-but-2-enedioic acid |
| SMILES | COCc1cc(N2C[C@H]3CCN[C@H]3C2)cnc1Br.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H18BrN3O.C4H4O4/c1-18-8-10-4-11(5-16-13(10)14)17-6-9-2-3-15-12(9)7-17;5-3(6)1-2-4(7)8/h4-5,9,12,15H,2-3,6-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t9-,12+;/m1./s1 |
| InChIKey | ZVRFNUBDWDJWSA-MKBCNHKISA-N |
| XLogP | 1.50 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|