C13H17FN2O — CID 126534001
5-(4-fluoro-3-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 126534001) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 5-(4-fluoro-3-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 5-(4-fluoro-3-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126534001 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-(4-fluoro-3-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | COc1cc(N2CC3CCNC3C2)ccc1F |
| InChI | InChI=1S/C13H17FN2O/c1-17-13-6-10(2-3-11(13)14)16-7-9-4-5-15-12(9)8-16/h2-3,6,9,12,15H,4-5,7-8H2,1H3 |
| InChIKey | XXRRFOFLOXIUPL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |