C12H17Cl2FN2 — CID 155827288
(3aR,6aR)-5-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride (PubChem CID 155827288) has the molecular formula C12H17Cl2FN2 and a molecular weight of 279.19 g/mol. Its IUPAC name is (3aR,6aR)-5-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride.
| Compound Name | (3aR,6aR)-5-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 155827288 |
| Molecular Formula | C12H17Cl2FN2 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (3aR,6aR)-5-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc(N2C[C@H]3CCN[C@H]3C2)c1 |
| InChI | InChI=1S/C12H15FN2.2ClH/c13-10-2-1-3-11(6-10)15-7-9-4-5-14-12(9)8-15;;/h1-3,6,9,12,14H,4-5,7-8H2;2*1H/t9-,12+;;/m1../s1 |
| InChIKey | LRECWQVPXHUZIT-QVJGMPPOSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |