C15H23FN2 — CID 171540537
ethane;4-(3-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine (PubChem CID 171540537) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is ethane;4-(3-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine.
| Compound Name | ethane;4-(3-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171540537 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | ethane;4-(3-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine |
| SMILES | CC.Fc1cccc(N2CCCC3NCCC32)c1 |
| InChI | InChI=1S/C13H17FN2.C2H6/c14-10-3-1-4-11(9-10)16-8-2-5-12-13(16)6-7-15-12;1-2/h1,3-4,9,12-13,15H,2,5-8H2;1-2H3 |
| InChIKey | XOIGXHSDYYHNNL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |