C14H16N6O4 — CID 159656075
(1R,5S)-6-(5-azido-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(E)-but-2-enedioic acid (PubChem CID 159656075) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is (1R,5S)-6-(5-azido-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(E)-but-2-enedioic acid.
| Compound Name | (1R,5S)-6-(5-azido-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 159656075 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (1R,5S)-6-(5-azido-3-pyridinyl)-3,6-diazabicyclo[3.2.0]heptane;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.[N-]=[N+]=Nc1cncc(N2C[C@H]3CNC[C@H]32)c1 |
| InChI | InChI=1S/C10H12N6.C4H4O4/c11-15-14-8-1-9(4-13-3-8)16-6-7-2-12-5-10(7)16;5-3(6)1-2-4(7)8/h1,3-4,7,10,12H,2,5-6H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t7-,10-;/m1./s1 |
| InChIKey | MSEQZUGSSQUICS-AXQPOKSYSA-N |
| XLogP | 1.14 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|