C15H16ClN3O4 — CID 173043110
2-[(3aS,6aS)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-2-yl]but-2-enedioic acid (PubChem CID 173043110) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-[(3aS,6aS)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-2-yl]but-2-enedioic acid.
| Compound Name | 2-[(3aS,6aS)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 173043110 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[(3aS,6aS)-1-(6-chloro-3-pyridinyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-2-yl]but-2-enedioic acid |
| SMILES | O=C(O)C=C(C(=O)O)C1C[C@H]2CNC[C@H]2N1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H16ClN3O4/c16-13-2-1-9(6-18-13)19-11(3-8-5-17-7-12(8)19)10(15(22)23)4-14(20)21/h1-2,4,6,8,11-12,17H,3,5,7H2,(H,20,21)(H,22,23)/t8-,11?,12+/m0/s1 |
| InChIKey | UHDCCRKVGONCIC-ZRPCIRFQSA-N |
| XLogP | 1.00 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|