C11H16KN3O3Si — CID 160723156
potassium 4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate (PubChem CID 160723156) has the molecular formula C11H16KN3O3Si and a molecular weight of 305.45 g/mol. Its IUPAC name is potassium 4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate.
| Compound Name | potassium 4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate |
|---|---|
| PubChem CID | 160723156 |
| Molecular Formula | C11H16KN3O3Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | potassium 4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylate |
| SMILES | [C-]#[N+]c1cn(COCC[Si](C)(C)C)c(C(=O)[O-])n1.[K+] |
| InChI | InChI=1S/C11H17N3O3Si.K/c1-12-9-7-14(10(13-9)11(15)16)8-17-5-6-18(2,3)4;/h7H,5-6,8H2,2-4H3,(H,15,16);/q;+1/p-1 |
| InChIKey | HRUJFRLIHLKENM-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 71.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|