C17H25NO3Si — CID 167442852
5-(2-hydroxyethyl)-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one (PubChem CID 167442852) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one.
| Compound Name | 5-(2-hydroxyethyl)-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 167442852 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(CCO)cccc2c1=O |
| InChI | InChI=1S/C17H25NO3Si/c1-22(2,3)12-11-21-13-18-9-7-15-14(8-10-19)5-4-6-16(15)17(18)20/h4-7,9,19H,8,10-13H2,1-3H3 |
| InChIKey | GHNFTBKLUALYDG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|