C24H37NO5Si — CID 167442897
tert-butyl 3-[2-[1-oxo-2-(2-trimethylsilylethoxymethyl)isoquinolin-5-yl]ethoxy]propanoate (PubChem CID 167442897) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is tert-butyl 3-[2-[1-oxo-2-(2-trimethylsilylethoxymethyl)isoquinolin-5-yl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[1-oxo-2-(2-trimethylsilylethoxymethyl)isoquinolin-5-yl]ethoxy]propanoate |
|---|---|
| PubChem CID | 167442897 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | tert-butyl 3-[2-[1-oxo-2-(2-trimethylsilylethoxymethyl)isoquinolin-5-yl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc2c(=O)n(COCC[Si](C)(C)C)ccc12 |
| InChI | InChI=1S/C24H37NO5Si/c1-24(2,3)30-22(26)12-15-28-14-11-19-8-7-9-21-20(19)10-13-25(23(21)27)18-29-16-17-31(4,5)6/h7-10,13H,11-12,14-18H2,1-6H3 |
| InChIKey | DQZCSJDCOOXPNO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|