C16H20N2O3 — CID 166003207
tert-butyl 3-(quinoxalin-5-ylmethoxy)propanoate (PubChem CID 166003207) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 3-(quinoxalin-5-ylmethoxy)propanoate.
| Compound Name | tert-butyl 3-(quinoxalin-5-ylmethoxy)propanoate |
|---|---|
| PubChem CID | 166003207 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 3-(quinoxalin-5-ylmethoxy)propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCc1cccc2nccnc12 |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,3)21-14(19)7-10-20-11-12-5-4-6-13-15(12)18-9-8-17-13/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | UMOPZCPPJHIZJS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|